C29H25FIO3S+ — CID 169051270
[4-(4-fluorophenyl)-2-methylbut-3-yn-2-yl] 2-[4-(5-iodo-1-benzothiophen-1-ium-1-yl)-2,6-dimethylphenoxy]acetate (PubChem CID 169051270) has the molecular formula C29H25FIO3S+ and a molecular weight of 599.49 g/mol. Its IUPAC name is [4-(4-fluorophenyl)-2-methylbut-3-yn-2-yl] 2-[4-(5-iodo-1-benzothiophen-1-ium-1-yl)-2,6-dimethylphenoxy]acetate.
| Compound Name | [4-(4-fluorophenyl)-2-methylbut-3-yn-2-yl] 2-[4-(5-iodo-1-benzothiophen-1-ium-1-yl)-2,6-dimethylphenoxy]acetate |
|---|---|
| PubChem CID | 169051270 |
| Molecular Formula | C29H25FIO3S+ |
| Molecular Weight | 599.49 g/mol |
| Exact Mass | 599.05 |
| IUPAC Name | [4-(4-fluorophenyl)-2-methylbut-3-yn-2-yl] 2-[4-(5-iodo-1-benzothiophen-1-ium-1-yl)-2,6-dimethylphenoxy]acetate |
| SMILES | Cc1cc(-[s+]2ccc3cc(I)ccc32)cc(C)c1OCC(=O)OC(C)(C)C#Cc1ccc(F)cc1 |
| InChI | InChI=1S/C29H25FIO3S/c1-19-15-25(35-14-12-22-17-24(31)9-10-26(22)35)16-20(2)28(19)33-18-27(32)34-29(3,4)13-11-21-5-7-23(30)8-6-21/h5-10,12,14-17H,18H2,1-4H3/q+1 |
| InChIKey | AHSKYTGXGXUAMS-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.49 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|