C31H28FO4S+ — CID 169051011
[4-(4-fluorophenyl)-2-methylbut-3-yn-2-yl] 2-[4-(2-acetyl-1-benzothiophen-1-ium-1-yl)-2,6-dimethylphenoxy]acetate (PubChem CID 169051011) has the molecular formula C31H28FO4S+ and a molecular weight of 515.63 g/mol. Its IUPAC name is [4-(4-fluorophenyl)-2-methylbut-3-yn-2-yl] 2-[4-(2-acetyl-1-benzothiophen-1-ium-1-yl)-2,6-dimethylphenoxy]acetate.
| Compound Name | [4-(4-fluorophenyl)-2-methylbut-3-yn-2-yl] 2-[4-(2-acetyl-1-benzothiophen-1-ium-1-yl)-2,6-dimethylphenoxy]acetate |
|---|---|
| PubChem CID | 169051011 |
| Molecular Formula | C31H28FO4S+ |
| Molecular Weight | 515.63 g/mol |
| Exact Mass | 515.17 |
| IUPAC Name | [4-(4-fluorophenyl)-2-methylbut-3-yn-2-yl] 2-[4-(2-acetyl-1-benzothiophen-1-ium-1-yl)-2,6-dimethylphenoxy]acetate |
| SMILES | CC(=O)c1cc2ccccc2[s+]1-c1cc(C)c(OCC(=O)OC(C)(C)C#Cc2ccc(F)cc2)c(C)c1 |
| InChI | InChI=1S/C31H28FO4S/c1-20-16-26(37-27-9-7-6-8-24(27)18-28(37)22(3)33)17-21(2)30(20)35-19-29(34)36-31(4,5)15-14-23-10-12-25(32)13-11-23/h6-13,16-18H,19H2,1-5H3/q+1 |
| InChIKey | PNSGWRFESNMBQH-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.63 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|