C23H31O3S+ — CID 169051576
(1-ethynylcyclohexyl) 2-[2,6-dimethyl-4-(thian-1-ium-1-yl)phenoxy]acetate (PubChem CID 169051576) has the molecular formula C23H31O3S+ and a molecular weight of 387.57 g/mol. Its IUPAC name is (1-ethynylcyclohexyl) 2-[2,6-dimethyl-4-(thian-1-ium-1-yl)phenoxy]acetate.
| Compound Name | (1-ethynylcyclohexyl) 2-[2,6-dimethyl-4-(thian-1-ium-1-yl)phenoxy]acetate |
|---|---|
| PubChem CID | 169051576 |
| Molecular Formula | C23H31O3S+ |
| Molecular Weight | 387.57 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | (1-ethynylcyclohexyl) 2-[2,6-dimethyl-4-(thian-1-ium-1-yl)phenoxy]acetate |
| SMILES | C#CC1(OC(=O)COc2c(C)cc([S+]3CCCCC3)cc2C)CCCCC1 |
| InChI | InChI=1S/C23H31O3S/c1-4-23(11-7-5-8-12-23)26-21(24)17-25-22-18(2)15-20(16-19(22)3)27-13-9-6-10-14-27/h1,15-16H,5-14,17H2,2-3H3/q+1 |
| InChIKey | PYJZYQRDSYMJSB-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.57 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|