C17H25O3S+ — CID 59080181
tert-butyl 2-[3-methyl-4-(thiolan-1-ium-1-yl)phenoxy]acetate (PubChem CID 59080181) has the molecular formula C17H25O3S+ and a molecular weight of 309.45 g/mol. Its IUPAC name is tert-butyl 2-[3-methyl-4-(thiolan-1-ium-1-yl)phenoxy]acetate.
| Compound Name | tert-butyl 2-[3-methyl-4-(thiolan-1-ium-1-yl)phenoxy]acetate |
|---|---|
| PubChem CID | 59080181 |
| Molecular Formula | C17H25O3S+ |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | tert-butyl 2-[3-methyl-4-(thiolan-1-ium-1-yl)phenoxy]acetate |
| SMILES | Cc1cc(OCC(=O)OC(C)(C)C)ccc1[S+]1CCCC1 |
| InChI | InChI=1S/C17H25O3S/c1-13-11-14(19-12-16(18)20-17(2,3)4)7-8-15(13)21-9-5-6-10-21/h7-8,11H,5-6,9-10,12H2,1-4H3/q+1 |
| InChIKey | QCBGKZDXPHTWGX-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|