C18H18N2O2 — CID 155373516
(1-ethynylcyclobutyl) 3-(1-phenylethyl)imidazole-4-carboxylate (PubChem CID 155373516) has the molecular formula C18H18N2O2 and a molecular weight of 294.35 g/mol. Its IUPAC name is (1-ethynylcyclobutyl) 3-(1-phenylethyl)imidazole-4-carboxylate.
| Compound Name | (1-ethynylcyclobutyl) 3-(1-phenylethyl)imidazole-4-carboxylate |
|---|---|
| PubChem CID | 155373516 |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | (1-ethynylcyclobutyl) 3-(1-phenylethyl)imidazole-4-carboxylate |
| SMILES | C#CC1(OC(=O)c2cncn2C(C)c2ccccc2)CCC1 |
| InChI | InChI=1S/C18H18N2O2/c1-3-18(10-7-11-18)22-17(21)16-12-19-13-20(16)14(2)15-8-5-4-6-9-15/h1,4-6,8-9,12-14H,7,10-11H2,2H3 |
| InChIKey | PXTRKUSGFVKEDU-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|