C16H18N2O3 — CID 129313659
(2-methyl-3-oxopropyl) 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate (PubChem CID 129313659) has the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. Its IUPAC name is (2-methyl-3-oxopropyl) 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate.
| Compound Name | (2-methyl-3-oxopropyl) 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 129313659 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | (2-methyl-3-oxopropyl) 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate |
| SMILES | CC(C=O)COC(=O)c1cncn1[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C16H18N2O3/c1-12(9-19)10-21-16(20)15-8-17-11-18(15)13(2)14-6-4-3-5-7-14/h3-9,11-13H,10H2,1-2H3/t12?,13-/m1/s1 |
| InChIKey | ZSBRVVUBJNSJGM-ZGTCLIOFSA-N |
| XLogP | 2.48 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|