About [(E)-hex-3-en-3-yl] 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate
[(E)-hex-3-en-3-yl] 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate (PubChem CID 155325874) has the molecular formula C18H22N2O2
and a molecular weight of 298.39 g/mol. Its IUPAC name is [(E)-hex-3-en-3-yl] 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate.
Molecular Properties
| Compound Name | [(E)-hex-3-en-3-yl] 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate |
| PubChem CID | 155325874 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | [(E)-hex-3-en-3-yl] 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate |
| SMILES | CC/C=C(\CC)OC(=O)c1cncn1[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C18H22N2O2/c1-4-9-16(5-2)22-18(21)17-12-19-13-20(17)14(3)15-10-7-6-8-11-15/h6-14H,4-5H2,1-3H3/b16-9+/t14-/m1/s1 |
| InChIKey | SGDUPUADTIRRGJ-BRYYZUPOSA-N |
| XLogP | 4.35 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze [(E)-hex-3-en-3-yl] 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-hex-3-en-3-yl] 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate?
The IUPAC name of [(E)-hex-3-en-3-yl] 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate (CID 155325874) is [(E)-hex-3-en-3-yl] 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate.
What is the SMILES notation for [(E)-hex-3-en-3-yl] 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate?
The canonical SMILES for [(E)-hex-3-en-3-yl] 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate is CC/C=C(\CC)OC(=O)c1cncn1[C@H](C)c1ccccc1.
What is the InChIKey of [(E)-hex-3-en-3-yl] 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate?
The InChIKey is SGDUPUADTIRRGJ-BRYYZUPOSA-N. The full InChI is InChI=1S/C18H22N2O2/c1-4-9-16(5-2)22-18(21)17-12-19-13-20(17)14(3)15-10-7-6-8-11-15/h6-14H,4-5H2,1-3H3/b16-9+/t14-/m1/s1.
What are the key properties of [(E)-hex-3-en-3-yl] 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate?
[(E)-hex-3-en-3-yl] 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate has a molecular weight of 298.39 g/mol, XLogP of 4.35, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-hex-3-en-3-yl] 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate is sourced from PubChem (CID 155325874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).