C22H22N2O3 — CID 118246219
(3-oxo-2-phenylbutyl) 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate (PubChem CID 118246219) has the molecular formula C22H22N2O3 and a molecular weight of 362.43 g/mol. Its IUPAC name is (3-oxo-2-phenylbutyl) 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate.
| Compound Name | (3-oxo-2-phenylbutyl) 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 118246219 |
| Molecular Formula | C22H22N2O3 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | (3-oxo-2-phenylbutyl) 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate |
| SMILES | CC(=O)C(COC(=O)c1cncn1[C@H](C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H22N2O3/c1-16(18-9-5-3-6-10-18)24-15-23-13-21(24)22(26)27-14-20(17(2)25)19-11-7-4-8-12-19/h3-13,15-16,20H,14H2,1-2H3/t16-,20?/m1/s1 |
| InChIKey | AXNAZOHGAIISSB-QRIPLOBPSA-N |
| XLogP | 4.02 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |