C18H22N2O3 — CID 174880490
[1-(methoxymethyl)cyclopropyl]methyl 3-(1-phenylethyl)imidazole-4-carboxylate (PubChem CID 174880490) has the molecular formula C18H22N2O3 and a molecular weight of 314.38 g/mol. Its IUPAC name is [1-(methoxymethyl)cyclopropyl]methyl 3-(1-phenylethyl)imidazole-4-carboxylate.
| Compound Name | [1-(methoxymethyl)cyclopropyl]methyl 3-(1-phenylethyl)imidazole-4-carboxylate |
|---|---|
| PubChem CID | 174880490 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | [1-(methoxymethyl)cyclopropyl]methyl 3-(1-phenylethyl)imidazole-4-carboxylate |
| SMILES | COCC1(COC(=O)c2cncn2C(C)c2ccccc2)CC1 |
| InChI | InChI=1S/C18H22N2O3/c1-14(15-6-4-3-5-7-15)20-13-19-10-16(20)17(21)23-12-18(8-9-18)11-22-2/h3-7,10,13-14H,8-9,11-12H2,1-2H3 |
| InChIKey | LGZAIBJNQHGNPB-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |