C15H18N2O3 — CID 167321198
2,2-dimethoxy-1-[3-[(1R)-1-phenylethyl]imidazol-4-yl]ethanone (PubChem CID 167321198) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is 2,2-dimethoxy-1-[3-[(1R)-1-phenylethyl]imidazol-4-yl]ethanone.
| Compound Name | 2,2-dimethoxy-1-[3-[(1R)-1-phenylethyl]imidazol-4-yl]ethanone |
|---|---|
| PubChem CID | 167321198 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 2,2-dimethoxy-1-[3-[(1R)-1-phenylethyl]imidazol-4-yl]ethanone |
| SMILES | COC(OC)C(=O)c1cncn1[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C15H18N2O3/c1-11(12-7-5-4-6-8-12)17-10-16-9-13(17)14(18)15(19-2)20-3/h4-11,15H,1-3H3/t11-/m1/s1 |
| InChIKey | AGGHPMWSYBZATH-LLVKDONJSA-N |
| XLogP | 2.29 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|