C15H16N2O5 — CID 154601739
methoxycarbonyloxymethyl 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate (PubChem CID 154601739) has the molecular formula C15H16N2O5 and a molecular weight of 304.30 g/mol. Its IUPAC name is methoxycarbonyloxymethyl 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate.
| Compound Name | methoxycarbonyloxymethyl 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 154601739 |
| Molecular Formula | C15H16N2O5 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | methoxycarbonyloxymethyl 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate |
| SMILES | COC(=O)OCOC(=O)c1cncn1[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C15H16N2O5/c1-11(12-6-4-3-5-7-12)17-9-16-8-13(17)14(18)21-10-22-15(19)20-2/h3-9,11H,10H2,1-2H3/t11-/m1/s1 |
| InChIKey | SORKBLZNEHSZRC-LLVKDONJSA-N |
| XLogP | 2.39 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|