C17H20N2O4 — CID 71657701
[(2R)-4-methoxy-4-oxobutan-2-yl] 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate (PubChem CID 71657701) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is [(2R)-4-methoxy-4-oxobutan-2-yl] 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate.
| Compound Name | [(2R)-4-methoxy-4-oxobutan-2-yl] 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 71657701 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | [(2R)-4-methoxy-4-oxobutan-2-yl] 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate |
| SMILES | COC(=O)C[C@@H](C)OC(=O)c1cncn1[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C17H20N2O4/c1-12(9-16(20)22-3)23-17(21)15-10-18-11-19(15)13(2)14-7-5-4-6-8-14/h4-8,10-13H,9H2,1-3H3/t12-,13-/m1/s1 |
| InChIKey | AJVRMDXELSTWCA-CHWSQXEVSA-N |
| XLogP | 2.60 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |