About [3-methoxy-2-(1,4-oxazin-4-yl)-3-oxopropyl] 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate
[3-methoxy-2-(1,4-oxazin-4-yl)-3-oxopropyl] 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate (PubChem CID 71656298) has the molecular formula C20H21N3O5
and a molecular weight of 383.40 g/mol. Its IUPAC name is [3-methoxy-2-(1,4-oxazin-4-yl)-3-oxopropyl] 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate.
Molecular Properties
| Compound Name | [3-methoxy-2-(1,4-oxazin-4-yl)-3-oxopropyl] 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate |
| PubChem CID | 71656298 |
| Molecular Formula | C20H21N3O5 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | [3-methoxy-2-(1,4-oxazin-4-yl)-3-oxopropyl] 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate |
| SMILES | COC(=O)C(COC(=O)c1cncn1[C@H](C)c1ccccc1)N1C=COC=C1 |
| InChI | InChI=1S/C20H21N3O5/c1-15(16-6-4-3-5-7-16)23-14-21-12-17(23)20(25)28-13-18(19(24)26-2)22-8-10-27-11-9-22/h3-12,14-15,18H,13H2,1-2H3/t15-,18?/m1/s1 |
| InChIKey | OXMUJGLUNARZQE-NNJIEVJOSA-N |
| XLogP | 2.47 |
| TPSA | 82.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze [3-methoxy-2-(1,4-oxazin-4-yl)-3-oxopropyl] 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-methoxy-2-(1,4-oxazin-4-yl)-3-oxopropyl] 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate?
The IUPAC name of [3-methoxy-2-(1,4-oxazin-4-yl)-3-oxopropyl] 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate (CID 71656298) is [3-methoxy-2-(1,4-oxazin-4-yl)-3-oxopropyl] 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate.
What is the SMILES notation for [3-methoxy-2-(1,4-oxazin-4-yl)-3-oxopropyl] 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate?
The canonical SMILES for [3-methoxy-2-(1,4-oxazin-4-yl)-3-oxopropyl] 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate is COC(=O)C(COC(=O)c1cncn1[C@H](C)c1ccccc1)N1C=COC=C1.
What is the InChIKey of [3-methoxy-2-(1,4-oxazin-4-yl)-3-oxopropyl] 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate?
The InChIKey is OXMUJGLUNARZQE-NNJIEVJOSA-N. The full InChI is InChI=1S/C20H21N3O5/c1-15(16-6-4-3-5-7-16)23-14-21-12-17(23)20(25)28-13-18(19(24)26-2)22-8-10-27-11-9-22/h3-12,14-15,18H,13H2,1-2H3/t15-,18?/m1/s1.
What are the key properties of [3-methoxy-2-(1,4-oxazin-4-yl)-3-oxopropyl] 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate?
[3-methoxy-2-(1,4-oxazin-4-yl)-3-oxopropyl] 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate has a molecular weight of 383.40 g/mol, XLogP of 2.47, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [3-methoxy-2-(1,4-oxazin-4-yl)-3-oxopropyl] 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate is sourced from PubChem (CID 71656298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).