C18H20N2O5 — CID 78140425
(3-methoxycarbonyloxetan-3-yl)methyl 3-(1-phenylethyl)imidazole-4-carboxylate (PubChem CID 78140425) has the molecular formula C18H20N2O5 and a molecular weight of 344.37 g/mol. Its IUPAC name is (3-methoxycarbonyloxetan-3-yl)methyl 3-(1-phenylethyl)imidazole-4-carboxylate.
| Compound Name | (3-methoxycarbonyloxetan-3-yl)methyl 3-(1-phenylethyl)imidazole-4-carboxylate |
|---|---|
| PubChem CID | 78140425 |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | (3-methoxycarbonyloxetan-3-yl)methyl 3-(1-phenylethyl)imidazole-4-carboxylate |
| SMILES | COC(=O)C1(COC(=O)c2cncn2C(C)c2ccccc2)COC1 |
| InChI | InChI=1S/C18H20N2O5/c1-13(14-6-4-3-5-7-14)20-12-19-8-15(20)16(21)25-11-18(9-24-10-18)17(22)23-2/h3-8,12-13H,9-11H2,1-2H3 |
| InChIKey | BOOJNJWXDNAGTI-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |