C17H18N2O4 — CID 155373567
[3-(oxiran-2-yl)oxetan-3-yl] 3-(1-phenylethyl)imidazole-4-carboxylate (PubChem CID 155373567) has the molecular formula C17H18N2O4 and a molecular weight of 314.34 g/mol. Its IUPAC name is [3-(oxiran-2-yl)oxetan-3-yl] 3-(1-phenylethyl)imidazole-4-carboxylate.
| Compound Name | [3-(oxiran-2-yl)oxetan-3-yl] 3-(1-phenylethyl)imidazole-4-carboxylate |
|---|---|
| PubChem CID | 155373567 |
| Molecular Formula | C17H18N2O4 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | [3-(oxiran-2-yl)oxetan-3-yl] 3-(1-phenylethyl)imidazole-4-carboxylate |
| SMILES | CC(c1ccccc1)n1cncc1C(=O)OC1(C2CO2)COC1 |
| InChI | InChI=1S/C17H18N2O4/c1-12(13-5-3-2-4-6-13)19-11-18-7-14(19)16(20)23-17(9-21-10-17)15-8-22-15/h2-7,11-12,15H,8-10H2,1H3 |
| InChIKey | VUZOCULTLDZROI-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 65.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|