C19H22N2O3 — CID 118246216
(1-acetylcyclobutyl)methyl 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate (PubChem CID 118246216) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is (1-acetylcyclobutyl)methyl 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate.
| Compound Name | (1-acetylcyclobutyl)methyl 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 118246216 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | (1-acetylcyclobutyl)methyl 3-[(1R)-1-phenylethyl]imidazole-4-carboxylate |
| SMILES | CC(=O)C1(COC(=O)c2cncn2[C@H](C)c2ccccc2)CCC1 |
| InChI | InChI=1S/C19H22N2O3/c1-14(16-7-4-3-5-8-16)21-13-20-11-17(21)18(23)24-12-19(15(2)22)9-6-10-19/h3-5,7-8,11,13-14H,6,9-10,12H2,1-2H3/t14-/m1/s1 |
| InChIKey | VVHSSOKPKOXAHA-CQSZACIVSA-N |
| XLogP | 3.41 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |