C15H17FN2O3 — CID 167321275
1-[5-fluoro-3-[(1R)-1-phenylethyl]imidazol-4-yl]-2,2-dimethoxyethanone (PubChem CID 167321275) has the molecular formula C15H17FN2O3 and a molecular weight of 292.31 g/mol. Its IUPAC name is 1-[5-fluoro-3-[(1R)-1-phenylethyl]imidazol-4-yl]-2,2-dimethoxyethanone.
| Compound Name | 1-[5-fluoro-3-[(1R)-1-phenylethyl]imidazol-4-yl]-2,2-dimethoxyethanone |
|---|---|
| PubChem CID | 167321275 |
| Molecular Formula | C15H17FN2O3 |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 1-[5-fluoro-3-[(1R)-1-phenylethyl]imidazol-4-yl]-2,2-dimethoxyethanone |
| SMILES | COC(OC)C(=O)c1c(F)ncn1[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C15H17FN2O3/c1-10(11-7-5-4-6-8-11)18-9-17-14(16)12(18)13(19)15(20-2)21-3/h4-10,15H,1-3H3/t10-/m1/s1 |
| InChIKey | BPRUVNFPLCMBOH-SNVBAGLBSA-N |
| XLogP | 2.43 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|