C19H23FN2O2 — CID 167321518
1-[5-fluoro-3-[(1R)-1-phenylethyl]imidazol-4-yl]-2-[1-(methoxymethyl)cyclobutyl]ethanone (PubChem CID 167321518) has the molecular formula C19H23FN2O2 and a molecular weight of 330.40 g/mol. Its IUPAC name is 1-[5-fluoro-3-[(1R)-1-phenylethyl]imidazol-4-yl]-2-[1-(methoxymethyl)cyclobutyl]ethanone.
| Compound Name | 1-[5-fluoro-3-[(1R)-1-phenylethyl]imidazol-4-yl]-2-[1-(methoxymethyl)cyclobutyl]ethanone |
|---|---|
| PubChem CID | 167321518 |
| Molecular Formula | C19H23FN2O2 |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 1-[5-fluoro-3-[(1R)-1-phenylethyl]imidazol-4-yl]-2-[1-(methoxymethyl)cyclobutyl]ethanone |
| SMILES | COCC1(CC(=O)c2c(F)ncn2[C@H](C)c2ccccc2)CCC1 |
| InChI | InChI=1S/C19H23FN2O2/c1-14(15-7-4-3-5-8-15)22-13-21-18(20)17(22)16(23)11-19(12-24-2)9-6-10-19/h3-5,7-8,13-14H,6,9-12H2,1-2H3/t14-/m1/s1 |
| InChIKey | QQGOXMLHERWJTE-CQSZACIVSA-N |
| XLogP | 4.02 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.40 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |