C18H19FN2OS — CID 155325847
S-(2-methylpent-3-yn-2-yl) 5-fluoro-3-[(1R)-1-phenylethyl]imidazole-4-carbothioate (PubChem CID 155325847) has the molecular formula C18H19FN2OS and a molecular weight of 330.43 g/mol. Its IUPAC name is S-(2-methylpent-3-yn-2-yl) 5-fluoro-3-[(1R)-1-phenylethyl]imidazole-4-carbothioate.
| Compound Name | S-(2-methylpent-3-yn-2-yl) 5-fluoro-3-[(1R)-1-phenylethyl]imidazole-4-carbothioate |
|---|---|
| PubChem CID | 155325847 |
| Molecular Formula | C18H19FN2OS |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | S-(2-methylpent-3-yn-2-yl) 5-fluoro-3-[(1R)-1-phenylethyl]imidazole-4-carbothioate |
| SMILES | CC#CC(C)(C)SC(=O)c1c(F)ncn1[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C18H19FN2OS/c1-5-11-18(3,4)23-17(22)15-16(19)20-12-21(15)13(2)14-9-7-6-8-10-14/h6-10,12-13H,1-4H3/t13-/m1/s1 |
| InChIKey | SWNDSVGIEBQJKT-CYBMUJFWSA-N |
| XLogP | 4.31 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|