C18H17FN2OS2 — CID 155643820
S-(3-propa-1,2-dienylthietan-3-yl) 5-fluoro-3-[(1R)-1-phenylethyl]imidazole-4-carbothioate (PubChem CID 155643820) has the molecular formula C18H17FN2OS2 and a molecular weight of 360.48 g/mol. Its IUPAC name is S-(3-propa-1,2-dienylthietan-3-yl) 5-fluoro-3-[(1R)-1-phenylethyl]imidazole-4-carbothioate.
| Compound Name | S-(3-propa-1,2-dienylthietan-3-yl) 5-fluoro-3-[(1R)-1-phenylethyl]imidazole-4-carbothioate |
|---|---|
| PubChem CID | 155643820 |
| Molecular Formula | C18H17FN2OS2 |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | S-(3-propa-1,2-dienylthietan-3-yl) 5-fluoro-3-[(1R)-1-phenylethyl]imidazole-4-carbothioate |
| SMILES | C=C=CC1(SC(=O)c2c(F)ncn2[C@H](C)c2ccccc2)CSC1 |
| InChI | InChI=1S/C18H17FN2OS2/c1-3-9-18(10-23-11-18)24-17(22)15-16(19)20-12-21(15)13(2)14-7-5-4-6-8-14/h4-9,12-13H,1,10-11H2,2H3/t13-/m1/s1 |
| InChIKey | NDYHTKTXNXLTBA-CYBMUJFWSA-N |
| XLogP | 4.33 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|