C20H23FN2O2 — CID 155325774
(1-ethenylcyclohexyl) 5-fluoro-3-[(1R)-1-phenylethyl]imidazole-4-carboxylate (PubChem CID 155325774) has the molecular formula C20H23FN2O2 and a molecular weight of 342.41 g/mol. Its IUPAC name is (1-ethenylcyclohexyl) 5-fluoro-3-[(1R)-1-phenylethyl]imidazole-4-carboxylate.
| Compound Name | (1-ethenylcyclohexyl) 5-fluoro-3-[(1R)-1-phenylethyl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 155325774 |
| Molecular Formula | C20H23FN2O2 |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | (1-ethenylcyclohexyl) 5-fluoro-3-[(1R)-1-phenylethyl]imidazole-4-carboxylate |
| SMILES | C=CC1(OC(=O)c2c(F)ncn2[C@H](C)c2ccccc2)CCCCC1 |
| InChI | InChI=1S/C20H23FN2O2/c1-3-20(12-8-5-9-13-20)25-19(24)17-18(21)22-14-23(17)15(2)16-10-6-4-7-11-16/h3-4,6-7,10-11,14-15H,1,5,8-9,12-13H2,2H3/t15-/m1/s1 |
| InChIKey | ADRQPOYVDQUBDX-OAHLLOKOSA-N |
| XLogP | 4.68 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|