C19H21FN2O2 — CID 139383408
(1-ethenylcyclopentyl) 5-fluoro-3-[(1R)-1-phenylethyl]imidazole-4-carboxylate (PubChem CID 139383408) has the molecular formula C19H21FN2O2 and a molecular weight of 328.39 g/mol. Its IUPAC name is (1-ethenylcyclopentyl) 5-fluoro-3-[(1R)-1-phenylethyl]imidazole-4-carboxylate.
| Compound Name | (1-ethenylcyclopentyl) 5-fluoro-3-[(1R)-1-phenylethyl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 139383408 |
| Molecular Formula | C19H21FN2O2 |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | (1-ethenylcyclopentyl) 5-fluoro-3-[(1R)-1-phenylethyl]imidazole-4-carboxylate |
| SMILES | C=CC1(OC(=O)c2c(F)ncn2[C@H](C)c2ccccc2)CCCC1 |
| InChI | InChI=1S/C19H21FN2O2/c1-3-19(11-7-8-12-19)24-18(23)16-17(20)21-13-22(16)14(2)15-9-5-4-6-10-15/h3-6,9-10,13-14H,1,7-8,11-12H2,2H3/t14-/m1/s1 |
| InChIKey | JFSTYFFNBOYTMU-CQSZACIVSA-N |
| XLogP | 4.29 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|