C23H26N2O3 — CID 177334658
2-methylpropyl 3-[1-(4-phenylmethoxyphenyl)ethyl]imidazole-4-carboxylate (PubChem CID 177334658) has the molecular formula C23H26N2O3 and a molecular weight of 378.47 g/mol. Its IUPAC name is 2-methylpropyl 3-[1-(4-phenylmethoxyphenyl)ethyl]imidazole-4-carboxylate.
| Compound Name | 2-methylpropyl 3-[1-(4-phenylmethoxyphenyl)ethyl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 177334658 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 2-methylpropyl 3-[1-(4-phenylmethoxyphenyl)ethyl]imidazole-4-carboxylate |
| SMILES | CC(C)COC(=O)c1cncn1C(C)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C23H26N2O3/c1-17(2)14-28-23(26)22-13-24-16-25(22)18(3)20-9-11-21(12-10-20)27-15-19-7-5-4-6-8-19/h4-13,16-18H,14-15H2,1-3H3 |
| InChIKey | YIIJSHUOOPCYPZ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |