C29H25F6O3S+ — CID 171589572
[1-cyclohexyl-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl] 5-phenyldibenzothiophen-5-ium-2-carboxylate (PubChem CID 171589572) has the molecular formula C29H25F6O3S+ and a molecular weight of 567.57 g/mol. Its IUPAC name is [1-cyclohexyl-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl] 5-phenyldibenzothiophen-5-ium-2-carboxylate.
| Compound Name | [1-cyclohexyl-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl] 5-phenyldibenzothiophen-5-ium-2-carboxylate |
|---|---|
| PubChem CID | 171589572 |
| Molecular Formula | C29H25F6O3S+ |
| Molecular Weight | 567.57 g/mol |
| Exact Mass | 567.14 |
| IUPAC Name | [1-cyclohexyl-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl] 5-phenyldibenzothiophen-5-ium-2-carboxylate |
| SMILES | O=C(OC(C1CCCCC1)C(O)(C(F)(F)F)C(F)(F)F)c1ccc2c(c1)c1ccccc1[s+]2-c1ccccc1 |
| InChI | InChI=1S/C29H25F6O3S/c30-28(31,32)27(37,29(33,34)35)25(18-9-3-1-4-10-18)38-26(36)19-15-16-24-22(17-19)21-13-7-8-14-23(21)39(24)20-11-5-2-6-12-20/h2,5-8,11-18,25,37H,1,3-4,9-10H2/q+1 |
| InChIKey | LMCHCPBDMDIADJ-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.57 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|