C34H30O4 — CID 11799630
[(1S)-2-(anthracen-9-ylmethoxy)-1-cyclohexyl-2-oxoethyl] naphthalene-2-carboxylate (PubChem CID 11799630) has the molecular formula C34H30O4 and a molecular weight of 502.61 g/mol. Its IUPAC name is [(1S)-2-(anthracen-9-ylmethoxy)-1-cyclohexyl-2-oxoethyl] naphthalene-2-carboxylate.
| Compound Name | [(1S)-2-(anthracen-9-ylmethoxy)-1-cyclohexyl-2-oxoethyl] naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 11799630 |
| Molecular Formula | C34H30O4 |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | [(1S)-2-(anthracen-9-ylmethoxy)-1-cyclohexyl-2-oxoethyl] naphthalene-2-carboxylate |
| SMILES | O=C(O[C@H](C(=O)OCc1c2ccccc2cc2ccccc12)C1CCCCC1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C34H30O4/c35-33(28-19-18-23-10-4-5-13-25(23)20-28)38-32(24-11-2-1-3-12-24)34(36)37-22-31-29-16-8-6-14-26(29)21-27-15-7-9-17-30(27)31/h4-10,13-21,24,32H,1-3,11-12,22H2/t32-/m0/s1 |
| InChIKey | MTXIIFNUKSAYMJ-YTTGMZPUSA-N |
| XLogP | 8.00 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|