C14H8F6O5S — CID 90130996
1,1,1,3,3,3-hexafluoropropan-2-yl 6-sulfinooxynaphthalene-1-carboxylate (PubChem CID 90130996) has the molecular formula C14H8F6O5S and a molecular weight of 402.27 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 6-sulfinooxynaphthalene-1-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 6-sulfinooxynaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 90130996 |
| Molecular Formula | C14H8F6O5S |
| Molecular Weight | 402.27 g/mol |
| Exact Mass | 402.00 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 6-sulfinooxynaphthalene-1-carboxylate |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)F)c1cccc2cc(OS(=O)O)ccc12 |
| InChI | InChI=1S/C14H8F6O5S/c15-13(16,17)12(14(18,19)20)24-11(21)10-3-1-2-7-6-8(25-26(22)23)4-5-9(7)10/h1-6,12H,(H,22,23) |
| InChIKey | RQKGNBRFFNTPEH-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.27 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|