C14H16F3N3O — CID 22077764
3-cyclopentyl-N-(diaminomethylidene)-5-(trifluoromethyl)benzamide (PubChem CID 22077764) has the molecular formula C14H16F3N3O and a molecular weight of 299.30 g/mol. Its IUPAC name is 3-cyclopentyl-N-(diaminomethylidene)-5-(trifluoromethyl)benzamide.
| Compound Name | 3-cyclopentyl-N-(diaminomethylidene)-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 22077764 |
| Molecular Formula | C14H16F3N3O |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 3-cyclopentyl-N-(diaminomethylidene)-5-(trifluoromethyl)benzamide |
| SMILES | NC(N)=NC(=O)c1cc(C2CCCC2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H16F3N3O/c15-14(16,17)11-6-9(8-3-1-2-4-8)5-10(7-11)12(21)20-13(18)19/h5-8H,1-4H2,(H4,18,19,20,21) |
| InChIKey | ROSFBFJHTPHRAH-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|