About N-[dibenzyl(oxo)-λ6-sulfanylidene]benzamide
N-[dibenzyl(oxo)-λ6-sulfanylidene]benzamide (PubChem CID 162418409) has the molecular formula C21H19NO2S
and a molecular weight of 349.46 g/mol. Its IUPAC name is N-[dibenzyl(oxo)-λ6-sulfanylidene]benzamide.
Molecular Properties
| Compound Name | N-[dibenzyl(oxo)-λ6-sulfanylidene]benzamide |
| PubChem CID | 162418409 |
| Molecular Formula | C21H19NO2S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | N-[dibenzyl(oxo)-λ6-sulfanylidene]benzamide |
| SMILES | O=C(N=S(=O)(Cc1ccccc1)Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H19NO2S/c23-21(20-14-8-3-9-15-20)22-25(24,16-18-10-4-1-5-11-18)17-19-12-6-2-7-13-19/h1-15H,16-17H2 |
| InChIKey | OJJVQAHAXWCMGI-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[dibenzyl(oxo)-λ6-sulfanylidene]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[dibenzyl(oxo)-λ6-sulfanylidene]benzamide?
The IUPAC name of N-[dibenzyl(oxo)-λ6-sulfanylidene]benzamide (CID 162418409) is N-[dibenzyl(oxo)-λ6-sulfanylidene]benzamide.
What is the SMILES notation for N-[dibenzyl(oxo)-λ6-sulfanylidene]benzamide?
The canonical SMILES for N-[dibenzyl(oxo)-λ6-sulfanylidene]benzamide is O=C(N=S(=O)(Cc1ccccc1)Cc1ccccc1)c1ccccc1.
What is the InChIKey of N-[dibenzyl(oxo)-λ6-sulfanylidene]benzamide?
The InChIKey is OJJVQAHAXWCMGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19NO2S/c23-21(20-14-8-3-9-15-20)22-25(24,16-18-10-4-1-5-11-18)17-19-12-6-2-7-13-19/h1-15H,16-17H2.
What are the key properties of N-[dibenzyl(oxo)-λ6-sulfanylidene]benzamide?
N-[dibenzyl(oxo)-λ6-sulfanylidene]benzamide has a molecular weight of 349.46 g/mol, XLogP of 4.70, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[dibenzyl(oxo)-λ6-sulfanylidene]benzamide is sourced from PubChem (CID 162418409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).