C23H22ClN3O4S — CID 46291835
3-(benzenesulfonamido)-4-[4-(4-chlorophenyl)piperazin-1-yl]benzoic acid (PubChem CID 46291835) has the molecular formula C23H22ClN3O4S and a molecular weight of 471.97 g/mol. Its IUPAC name is 3-(benzenesulfonamido)-4-[4-(4-chlorophenyl)piperazin-1-yl]benzoic acid.
| Compound Name | 3-(benzenesulfonamido)-4-[4-(4-chlorophenyl)piperazin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 46291835 |
| Molecular Formula | C23H22ClN3O4S |
| Molecular Weight | 471.97 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | 3-(benzenesulfonamido)-4-[4-(4-chlorophenyl)piperazin-1-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(N2CCN(c3ccc(Cl)cc3)CC2)c(NS(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C23H22ClN3O4S/c24-18-7-9-19(10-8-18)26-12-14-27(15-13-26)22-11-6-17(23(28)29)16-21(22)25-32(30,31)20-4-2-1-3-5-20/h1-11,16,25H,12-15H2,(H,28,29) |
| InChIKey | RWCCKQFLHOWSPF-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.97 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |