C13H11ClN2O5S — CID 808082
N'-(4-chlorophenyl)sulfonyl-2,4-dihydroxybenzohydrazide (PubChem CID 808082) has the molecular formula C13H11ClN2O5S and a molecular weight of 342.76 g/mol. Its IUPAC name is N'-(4-chlorophenyl)sulfonyl-2,4-dihydroxybenzohydrazide.
| Compound Name | N'-(4-chlorophenyl)sulfonyl-2,4-dihydroxybenzohydrazide |
|---|---|
| PubChem CID | 808082 |
| Molecular Formula | C13H11ClN2O5S |
| Molecular Weight | 342.76 g/mol |
| Exact Mass | 342.01 |
| IUPAC Name | N'-(4-chlorophenyl)sulfonyl-2,4-dihydroxybenzohydrazide |
| SMILES | O=C(NNS(=O)(=O)c1ccc(Cl)cc1)c1ccc(O)cc1O |
| InChI | InChI=1S/C13H11ClN2O5S/c14-8-1-4-10(5-2-8)22(20,21)16-15-13(19)11-6-3-9(17)7-12(11)18/h1-7,16-18H,(H,15,19) |
| InChIKey | CKBKEUZUVQZOPS-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.76 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|