C17H20N2O4S — CID 39324521
2-hydroxy-N'-[4-(2-methylpropyl)phenyl]sulfonylbenzohydrazide (PubChem CID 39324521) has the molecular formula C17H20N2O4S and a molecular weight of 348.42 g/mol. Its IUPAC name is 2-hydroxy-N'-[4-(2-methylpropyl)phenyl]sulfonylbenzohydrazide.
| Compound Name | 2-hydroxy-N'-[4-(2-methylpropyl)phenyl]sulfonylbenzohydrazide |
|---|---|
| PubChem CID | 39324521 |
| Molecular Formula | C17H20N2O4S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 2-hydroxy-N'-[4-(2-methylpropyl)phenyl]sulfonylbenzohydrazide |
| SMILES | CC(C)Cc1ccc(S(=O)(=O)NNC(=O)c2ccccc2O)cc1 |
| InChI | InChI=1S/C17H20N2O4S/c1-12(2)11-13-7-9-14(10-8-13)24(22,23)19-18-17(21)15-5-3-4-6-16(15)20/h3-10,12,19-20H,11H2,1-2H3,(H,18,21) |
| InChIKey | LNRJFYQLBIYQJP-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|