C16H18N2O4S — CID 8511154
2-hydroxy-N'-(4-propylphenyl)sulfonylbenzohydrazide (PubChem CID 8511154) has the molecular formula C16H18N2O4S and a molecular weight of 334.40 g/mol. Its IUPAC name is 2-hydroxy-N'-(4-propylphenyl)sulfonylbenzohydrazide.
| Compound Name | 2-hydroxy-N'-(4-propylphenyl)sulfonylbenzohydrazide |
|---|---|
| PubChem CID | 8511154 |
| Molecular Formula | C16H18N2O4S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 2-hydroxy-N'-(4-propylphenyl)sulfonylbenzohydrazide |
| SMILES | CCCc1ccc(S(=O)(=O)NNC(=O)c2ccccc2O)cc1 |
| InChI | InChI=1S/C16H18N2O4S/c1-2-5-12-8-10-13(11-9-12)23(21,22)18-17-16(20)14-6-3-4-7-15(14)19/h3-4,6-11,18-19H,2,5H2,1H3,(H,17,20) |
| InChIKey | UXNFFHVTWPPWGO-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|