C24H27N3O3S — CID 3510733
2-(2,6-diethylanilino)-N'-(4-methylphenyl)sulfonylbenzohydrazide (PubChem CID 3510733) has the molecular formula C24H27N3O3S and a molecular weight of 437.57 g/mol. Its IUPAC name is 2-(2,6-diethylanilino)-N'-(4-methylphenyl)sulfonylbenzohydrazide.
| Compound Name | 2-(2,6-diethylanilino)-N'-(4-methylphenyl)sulfonylbenzohydrazide |
|---|---|
| PubChem CID | 3510733 |
| Molecular Formula | C24H27N3O3S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | 2-(2,6-diethylanilino)-N'-(4-methylphenyl)sulfonylbenzohydrazide |
| SMILES | CCc1cccc(CC)c1Nc1ccccc1C(=O)NNS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H27N3O3S/c1-4-18-9-8-10-19(5-2)23(18)25-22-12-7-6-11-21(22)24(28)26-27-31(29,30)20-15-13-17(3)14-16-20/h6-16,25,27H,4-5H2,1-3H3,(H,26,28) |
| InChIKey | RQMLRYVXCDEUFA-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|