C24H27N3O5S2 — CID 10289140
N-[4-(benzenesulfonamidocarbamoyl)phenyl]-4-pentylbenzenesulfonamide (PubChem CID 10289140) has the molecular formula C24H27N3O5S2 and a molecular weight of 501.63 g/mol. Its IUPAC name is N-[4-(benzenesulfonamidocarbamoyl)phenyl]-4-pentylbenzenesulfonamide.
| Compound Name | N-[4-(benzenesulfonamidocarbamoyl)phenyl]-4-pentylbenzenesulfonamide |
|---|---|
| PubChem CID | 10289140 |
| Molecular Formula | C24H27N3O5S2 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.14 |
| IUPAC Name | N-[4-(benzenesulfonamidocarbamoyl)phenyl]-4-pentylbenzenesulfonamide |
| SMILES | CCCCCc1ccc(S(=O)(=O)Nc2ccc(C(=O)NNS(=O)(=O)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C24H27N3O5S2/c1-2-3-5-8-19-11-17-23(18-12-19)33(29,30)26-21-15-13-20(14-16-21)24(28)25-27-34(31,32)22-9-6-4-7-10-22/h4,6-7,9-18,26-27H,2-3,5,8H2,1H3,(H,25,28) |
| InChIKey | DINCBRNLTWPJLA-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|