C12H8Cl3N3O3S — CID 4729935
2,4-dichloro-N'-[(6-chloro-3-pyridinyl)sulfonyl]benzohydrazide (PubChem CID 4729935) has the molecular formula C12H8Cl3N3O3S and a molecular weight of 380.64 g/mol. Its IUPAC name is 2,4-dichloro-N'-[(6-chloro-3-pyridinyl)sulfonyl]benzohydrazide.
| Compound Name | 2,4-dichloro-N'-[(6-chloro-3-pyridinyl)sulfonyl]benzohydrazide |
|---|---|
| PubChem CID | 4729935 |
| Molecular Formula | C12H8Cl3N3O3S |
| Molecular Weight | 380.64 g/mol |
| Exact Mass | 378.94 |
| IUPAC Name | 2,4-dichloro-N'-[(6-chloro-3-pyridinyl)sulfonyl]benzohydrazide |
| SMILES | O=C(NNS(=O)(=O)c1ccc(Cl)nc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H8Cl3N3O3S/c13-7-1-3-9(10(14)5-7)12(19)17-18-22(20,21)8-2-4-11(15)16-6-8/h1-6,18H,(H,17,19) |
| InChIKey | AFIWABGWEAQPPE-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.64 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|