C19H16ClN3O3S — CID 4729945
N'-[(6-chloro-3-pyridinyl)sulfonyl]-2,2-diphenylacetohydrazide (PubChem CID 4729945) has the molecular formula C19H16ClN3O3S and a molecular weight of 401.88 g/mol. Its IUPAC name is N'-[(6-chloro-3-pyridinyl)sulfonyl]-2,2-diphenylacetohydrazide.
| Compound Name | N'-[(6-chloro-3-pyridinyl)sulfonyl]-2,2-diphenylacetohydrazide |
|---|---|
| PubChem CID | 4729945 |
| Molecular Formula | C19H16ClN3O3S |
| Molecular Weight | 401.88 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | N'-[(6-chloro-3-pyridinyl)sulfonyl]-2,2-diphenylacetohydrazide |
| SMILES | O=C(NNS(=O)(=O)c1ccc(Cl)nc1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H16ClN3O3S/c20-17-12-11-16(13-21-17)27(25,26)23-22-19(24)18(14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-13,18,23H,(H,22,24) |
| InChIKey | QZDSMNJIDAEZOA-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.88 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|