C16H19ClN4O3S — CID 2683676
N'-[(6-chloro-3-pyridinyl)sulfonyl]-4-(diethylamino)benzohydrazide (PubChem CID 2683676) has the molecular formula C16H19ClN4O3S and a molecular weight of 382.87 g/mol. Its IUPAC name is N'-[(6-chloro-3-pyridinyl)sulfonyl]-4-(diethylamino)benzohydrazide.
| Compound Name | N'-[(6-chloro-3-pyridinyl)sulfonyl]-4-(diethylamino)benzohydrazide |
|---|---|
| PubChem CID | 2683676 |
| Molecular Formula | C16H19ClN4O3S |
| Molecular Weight | 382.87 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | N'-[(6-chloro-3-pyridinyl)sulfonyl]-4-(diethylamino)benzohydrazide |
| SMILES | CCN(CC)c1ccc(C(=O)NNS(=O)(=O)c2ccc(Cl)nc2)cc1 |
| InChI | InChI=1S/C16H19ClN4O3S/c1-3-21(4-2)13-7-5-12(6-8-13)16(22)19-20-25(23,24)14-9-10-15(17)18-11-14/h5-11,20H,3-4H2,1-2H3,(H,19,22) |
| InChIKey | NUKBOLRGLFECJI-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.87 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|