C17H17ClF3N3O3S — CID 2563050
N'-(3-chloro-2,4,6-trifluorophenyl)sulfonyl-4-(diethylamino)benzohydrazide (PubChem CID 2563050) has the molecular formula C17H17ClF3N3O3S and a molecular weight of 435.86 g/mol. Its IUPAC name is N'-(3-chloro-2,4,6-trifluorophenyl)sulfonyl-4-(diethylamino)benzohydrazide.
| Compound Name | N'-(3-chloro-2,4,6-trifluorophenyl)sulfonyl-4-(diethylamino)benzohydrazide |
|---|---|
| PubChem CID | 2563050 |
| Molecular Formula | C17H17ClF3N3O3S |
| Molecular Weight | 435.86 g/mol |
| Exact Mass | 435.06 |
| IUPAC Name | N'-(3-chloro-2,4,6-trifluorophenyl)sulfonyl-4-(diethylamino)benzohydrazide |
| SMILES | CCN(CC)c1ccc(C(=O)NNS(=O)(=O)c2c(F)cc(F)c(Cl)c2F)cc1 |
| InChI | InChI=1S/C17H17ClF3N3O3S/c1-3-24(4-2)11-7-5-10(6-8-11)17(25)22-23-28(26,27)16-13(20)9-12(19)14(18)15(16)21/h5-9,23H,3-4H2,1-2H3,(H,22,25) |
| InChIKey | PBJCBBXQNIOTLV-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.86 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|