C19H22N4O4S — CID 9030537
4-(diethylamino)-N'-[(2-oxo-1,3-dihydroindol-5-yl)sulfonyl]benzohydrazide (PubChem CID 9030537) has the molecular formula C19H22N4O4S and a molecular weight of 402.48 g/mol. Its IUPAC name is 4-(diethylamino)-N'-[(2-oxo-1,3-dihydroindol-5-yl)sulfonyl]benzohydrazide.
| Compound Name | 4-(diethylamino)-N'-[(2-oxo-1,3-dihydroindol-5-yl)sulfonyl]benzohydrazide |
|---|---|
| PubChem CID | 9030537 |
| Molecular Formula | C19H22N4O4S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 4-(diethylamino)-N'-[(2-oxo-1,3-dihydroindol-5-yl)sulfonyl]benzohydrazide |
| SMILES | CCN(CC)c1ccc(C(=O)NNS(=O)(=O)c2ccc3c(c2)CC(=O)N3)cc1 |
| InChI | InChI=1S/C19H22N4O4S/c1-3-23(4-2)15-7-5-13(6-8-15)19(25)21-22-28(26,27)16-9-10-17-14(11-16)12-18(24)20-17/h5-11,22H,3-4,12H2,1-2H3,(H,20,24)(H,21,25) |
| InChIKey | YFZBCJRVZFXJGJ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|