C22H20Cl2N4O3S — CID 24956235
2,4-dichloro-N-[[6-(4-phenylpiperazin-1-yl)-3-pyridinyl]sulfonyl]benzamide (PubChem CID 24956235) has the molecular formula C22H20Cl2N4O3S and a molecular weight of 491.40 g/mol. Its IUPAC name is 2,4-dichloro-N-[[6-(4-phenylpiperazin-1-yl)-3-pyridinyl]sulfonyl]benzamide.
| Compound Name | 2,4-dichloro-N-[[6-(4-phenylpiperazin-1-yl)-3-pyridinyl]sulfonyl]benzamide |
|---|---|
| PubChem CID | 24956235 |
| Molecular Formula | C22H20Cl2N4O3S |
| Molecular Weight | 491.40 g/mol |
| Exact Mass | 490.06 |
| IUPAC Name | 2,4-dichloro-N-[[6-(4-phenylpiperazin-1-yl)-3-pyridinyl]sulfonyl]benzamide |
| SMILES | O=C(NS(=O)(=O)c1ccc(N2CCN(c3ccccc3)CC2)nc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C22H20Cl2N4O3S/c23-16-6-8-19(20(24)14-16)22(29)26-32(30,31)18-7-9-21(25-15-18)28-12-10-27(11-13-28)17-4-2-1-3-5-17/h1-9,14-15H,10-13H2,(H,26,29) |
| InChIKey | CMDJBAMWHCWPEK-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.40 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |