C22H22ClFN4O4S — CID 87306082
2-chloro-4-fluorobenzamide;6-(4-phenylpiperazin-1-yl)pyridine-3-sulfonic acid (PubChem CID 87306082) has the molecular formula C22H22ClFN4O4S and a molecular weight of 492.96 g/mol. Its IUPAC name is 2-chloro-4-fluorobenzamide;6-(4-phenylpiperazin-1-yl)pyridine-3-sulfonic acid.
| Compound Name | 2-chloro-4-fluorobenzamide;6-(4-phenylpiperazin-1-yl)pyridine-3-sulfonic acid |
|---|---|
| PubChem CID | 87306082 |
| Molecular Formula | C22H22ClFN4O4S |
| Molecular Weight | 492.96 g/mol |
| Exact Mass | 492.10 |
| IUPAC Name | 2-chloro-4-fluorobenzamide;6-(4-phenylpiperazin-1-yl)pyridine-3-sulfonic acid |
| SMILES | NC(=O)c1ccc(F)cc1Cl.O=S(=O)(O)c1ccc(N2CCN(c3ccccc3)CC2)nc1 |
| InChI | InChI=1S/C15H17N3O3S.C7H5ClFNO/c19-22(20,21)14-6-7-15(16-12-14)18-10-8-17(9-11-18)13-4-2-1-3-5-13;8-6-3-4(9)1-2-5(6)7(10)11/h1-7,12H,8-11H2,(H,19,20,21);1-3H,(H2,10,11) |
| InChIKey | CDWSMMVCWUZTOX-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 116.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.96 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|