C21H21Cl2N5O4S — CID 87307663
2,4-dichlorobenzamide;6-(4-pyridin-2-ylpiperazin-1-yl)pyridine-3-sulfonic acid (PubChem CID 87307663) has the molecular formula C21H21Cl2N5O4S and a molecular weight of 510.40 g/mol. Its IUPAC name is 2,4-dichlorobenzamide;6-(4-pyridin-2-ylpiperazin-1-yl)pyridine-3-sulfonic acid.
| Compound Name | 2,4-dichlorobenzamide;6-(4-pyridin-2-ylpiperazin-1-yl)pyridine-3-sulfonic acid |
|---|---|
| PubChem CID | 87307663 |
| Molecular Formula | C21H21Cl2N5O4S |
| Molecular Weight | 510.40 g/mol |
| Exact Mass | 509.07 |
| IUPAC Name | 2,4-dichlorobenzamide;6-(4-pyridin-2-ylpiperazin-1-yl)pyridine-3-sulfonic acid |
| SMILES | NC(=O)c1ccc(Cl)cc1Cl.O=S(=O)(O)c1ccc(N2CCN(c3ccccn3)CC2)nc1 |
| InChI | InChI=1S/C14H16N4O3S.C7H5Cl2NO/c19-22(20,21)12-4-5-14(16-11-12)18-9-7-17(8-10-18)13-3-1-2-6-15-13;8-4-1-2-5(7(10)11)6(9)3-4/h1-6,11H,7-10H2,(H,19,20,21);1-3H,(H2,10,11) |
| InChIKey | CJYASRUWADWJLT-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.40 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|