C18H14Cl2N2O5S — CID 87659609
2,4-dichlorobenzamide;6-phenoxypyridine-3-sulfonic acid (PubChem CID 87659609) has the molecular formula C18H14Cl2N2O5S and a molecular weight of 441.29 g/mol. Its IUPAC name is 2,4-dichlorobenzamide;6-phenoxypyridine-3-sulfonic acid.
| Compound Name | 2,4-dichlorobenzamide;6-phenoxypyridine-3-sulfonic acid |
|---|---|
| PubChem CID | 87659609 |
| Molecular Formula | C18H14Cl2N2O5S |
| Molecular Weight | 441.29 g/mol |
| Exact Mass | 440.00 |
| IUPAC Name | 2,4-dichlorobenzamide;6-phenoxypyridine-3-sulfonic acid |
| SMILES | NC(=O)c1ccc(Cl)cc1Cl.O=S(=O)(O)c1ccc(Oc2ccccc2)nc1 |
| InChI | InChI=1S/C11H9NO4S.C7H5Cl2NO/c13-17(14,15)10-6-7-11(12-8-10)16-9-4-2-1-3-5-9;8-4-1-2-5(7(10)11)6(9)3-4/h1-8H,(H,13,14,15);1-3H,(H2,10,11) |
| InChIKey | KWFFTLLZCIHJEP-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 119.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.29 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|