C20H12Cl2F6N2O4S — CID 87212311
6-[2,4-bis(trifluoromethyl)phenyl]pyridine-3-sulfonic acid;2,4-dichlorobenzamide (PubChem CID 87212311) has the molecular formula C20H12Cl2F6N2O4S and a molecular weight of 561.29 g/mol. Its IUPAC name is 6-[2,4-bis(trifluoromethyl)phenyl]pyridine-3-sulfonic acid;2,4-dichlorobenzamide.
| Compound Name | 6-[2,4-bis(trifluoromethyl)phenyl]pyridine-3-sulfonic acid;2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 87212311 |
| Molecular Formula | C20H12Cl2F6N2O4S |
| Molecular Weight | 561.29 g/mol |
| Exact Mass | 559.98 |
| IUPAC Name | 6-[2,4-bis(trifluoromethyl)phenyl]pyridine-3-sulfonic acid;2,4-dichlorobenzamide |
| SMILES | NC(=O)c1ccc(Cl)cc1Cl.O=S(=O)(O)c1ccc(-c2ccc(C(F)(F)F)cc2C(F)(F)F)nc1 |
| InChI | InChI=1S/C13H7F6NO3S.C7H5Cl2NO/c14-12(15,16)7-1-3-9(10(5-7)13(17,18)19)11-4-2-8(6-20-11)24(21,22)23;8-4-1-2-5(7(10)11)6(9)3-4/h1-6H,(H,21,22,23);1-3H,(H2,10,11) |
| InChIKey | IXTCXQXINAMUGL-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 110.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.29 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|