C20H15ClF4N2O4S — CID 87212315
6-(2-chlorophenyl)-5-methylpyridine-3-sulfonic acid;4-fluoro-2-(trifluoromethyl)benzamide (PubChem CID 87212315) has the molecular formula C20H15ClF4N2O4S and a molecular weight of 490.86 g/mol. Its IUPAC name is 6-(2-chlorophenyl)-5-methylpyridine-3-sulfonic acid;4-fluoro-2-(trifluoromethyl)benzamide.
| Compound Name | 6-(2-chlorophenyl)-5-methylpyridine-3-sulfonic acid;4-fluoro-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 87212315 |
| Molecular Formula | C20H15ClF4N2O4S |
| Molecular Weight | 490.86 g/mol |
| Exact Mass | 490.04 |
| IUPAC Name | 6-(2-chlorophenyl)-5-methylpyridine-3-sulfonic acid;4-fluoro-2-(trifluoromethyl)benzamide |
| SMILES | Cc1cc(S(=O)(=O)O)cnc1-c1ccccc1Cl.NC(=O)c1ccc(F)cc1C(F)(F)F |
| InChI | InChI=1S/C12H10ClNO3S.C8H5F4NO/c1-8-6-9(18(15,16)17)7-14-12(8)10-4-2-3-5-11(10)13;9-4-1-2-5(7(13)14)6(3-4)8(10,11)12/h2-7H,1H3,(H,15,16,17);1-3H,(H2,13,14) |
| InChIKey | OHBXLOYMBZAZNL-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 110.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.86 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|