C19H12Cl2LiN3O6 — CID 173235220
lithium;2-[(2,4-dichlorobenzoyl)amino]-5-[(5-nitro-2-pyridinyl)oxy]benzoic acid;hydride (PubChem CID 173235220) has the molecular formula C19H12Cl2LiN3O6 and a molecular weight of 456.17 g/mol. Its IUPAC name is lithium;2-[(2,4-dichlorobenzoyl)amino]-5-[(5-nitro-2-pyridinyl)oxy]benzoic acid;hydride.
| Compound Name | lithium;2-[(2,4-dichlorobenzoyl)amino]-5-[(5-nitro-2-pyridinyl)oxy]benzoic acid;hydride |
|---|---|
| PubChem CID | 173235220 |
| Molecular Formula | C19H12Cl2LiN3O6 |
| Molecular Weight | 456.17 g/mol |
| Exact Mass | 455.03 |
| IUPAC Name | lithium;2-[(2,4-dichlorobenzoyl)amino]-5-[(5-nitro-2-pyridinyl)oxy]benzoic acid;hydride |
| SMILES | O=C(Nc1ccc(Oc2ccc([N+](=O)[O-])cn2)cc1C(=O)O)c1ccc(Cl)cc1Cl.[H-].[Li+] |
| InChI | InChI=1S/C19H11Cl2N3O6.Li.H/c20-10-1-4-13(15(21)7-10)18(25)23-16-5-3-12(8-14(16)19(26)27)30-17-6-2-11(9-22-17)24(28)29;;/h1-9H,(H,23,25)(H,26,27);;/q;+1;-1 |
| InChIKey | UYDXPQWIRLALIT-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 131.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.17 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|