C28H16Cl2N4O10 — CID 5121715
5-[3-carboxy-4-[(2-chloro-5-nitrobenzoyl)amino]phenyl]-2-[(2-chloro-5-nitrobenzoyl)amino]benzoic acid (PubChem CID 5121715) has the molecular formula C28H16Cl2N4O10 and a molecular weight of 639.36 g/mol. Its IUPAC name is 5-[3-carboxy-4-[(2-chloro-5-nitrobenzoyl)amino]phenyl]-2-[(2-chloro-5-nitrobenzoyl)amino]benzoic acid.
| Compound Name | 5-[3-carboxy-4-[(2-chloro-5-nitrobenzoyl)amino]phenyl]-2-[(2-chloro-5-nitrobenzoyl)amino]benzoic acid |
|---|---|
| PubChem CID | 5121715 |
| Molecular Formula | C28H16Cl2N4O10 |
| Molecular Weight | 639.36 g/mol |
| Exact Mass | 638.02 |
| IUPAC Name | 5-[3-carboxy-4-[(2-chloro-5-nitrobenzoyl)amino]phenyl]-2-[(2-chloro-5-nitrobenzoyl)amino]benzoic acid |
| SMILES | O=C(Nc1ccc(-c2ccc(NC(=O)c3cc([N+](=O)[O-])ccc3Cl)c(C(=O)O)c2)cc1C(=O)O)c1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C28H16Cl2N4O10/c29-21-5-3-15(33(41)42)11-17(21)25(35)31-23-7-1-13(9-19(23)27(37)38)14-2-8-24(20(10-14)28(39)40)32-26(36)18-12-16(34(43)44)4-6-22(18)30/h1-12H,(H,31,35)(H,32,36)(H,37,38)(H,39,40) |
| InChIKey | SXZWOYJRLMBNKQ-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 219.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.36 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|