C21H13ClN4O4 — CID 1114790
2-chloro-5-nitro-N-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]benzamide (PubChem CID 1114790) has the molecular formula C21H13ClN4O4 and a molecular weight of 420.81 g/mol. Its IUPAC name is 2-chloro-5-nitro-N-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]benzamide.
| Compound Name | 2-chloro-5-nitro-N-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 1114790 |
| Molecular Formula | C21H13ClN4O4 |
| Molecular Weight | 420.81 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | 2-chloro-5-nitro-N-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(-c2nnc(-c3ccccc3)o2)cc1)c1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C21H13ClN4O4/c22-18-11-10-16(26(28)29)12-17(18)19(27)23-15-8-6-14(7-9-15)21-25-24-20(30-21)13-4-2-1-3-5-13/h1-12H,(H,23,27) |
| InChIKey | SPZKMPHVFLVMHQ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.81 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|