C16H17ClFN3O4S — CID 87658965
2-chloro-4-fluorobenzamide;6-pyrrolidin-1-ylpyridine-3-sulfonic acid (PubChem CID 87658965) has the molecular formula C16H17ClFN3O4S and a molecular weight of 401.85 g/mol. Its IUPAC name is 2-chloro-4-fluorobenzamide;6-pyrrolidin-1-ylpyridine-3-sulfonic acid.
| Compound Name | 2-chloro-4-fluorobenzamide;6-pyrrolidin-1-ylpyridine-3-sulfonic acid |
|---|---|
| PubChem CID | 87658965 |
| Molecular Formula | C16H17ClFN3O4S |
| Molecular Weight | 401.85 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | 2-chloro-4-fluorobenzamide;6-pyrrolidin-1-ylpyridine-3-sulfonic acid |
| SMILES | NC(=O)c1ccc(F)cc1Cl.O=S(=O)(O)c1ccc(N2CCCC2)nc1 |
| InChI | InChI=1S/C9H12N2O3S.C7H5ClFNO/c12-15(13,14)8-3-4-9(10-7-8)11-5-1-2-6-11;8-6-3-4(9)1-2-5(6)7(10)11/h3-4,7H,1-2,5-6H2,(H,12,13,14);1-3H,(H2,10,11) |
| InChIKey | BUQCKUBVSCYUOV-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 113.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.85 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|