C18H21ClFN3O4S — CID 87659249
2-chloro-4-fluorobenzamide;6-(4-methylpiperidin-1-yl)pyridine-3-sulfonic acid (PubChem CID 87659249) has the molecular formula C18H21ClFN3O4S and a molecular weight of 429.90 g/mol. Its IUPAC name is 2-chloro-4-fluorobenzamide;6-(4-methylpiperidin-1-yl)pyridine-3-sulfonic acid.
| Compound Name | 2-chloro-4-fluorobenzamide;6-(4-methylpiperidin-1-yl)pyridine-3-sulfonic acid |
|---|---|
| PubChem CID | 87659249 |
| Molecular Formula | C18H21ClFN3O4S |
| Molecular Weight | 429.90 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | 2-chloro-4-fluorobenzamide;6-(4-methylpiperidin-1-yl)pyridine-3-sulfonic acid |
| SMILES | CC1CCN(c2ccc(S(=O)(=O)O)cn2)CC1.NC(=O)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C11H16N2O3S.C7H5ClFNO/c1-9-4-6-13(7-5-9)11-3-2-10(8-12-11)17(14,15)16;8-6-3-4(9)1-2-5(6)7(10)11/h2-3,8-9H,4-7H2,1H3,(H,14,15,16);1-3H,(H2,10,11) |
| InChIKey | CSPQDMWCEWPJFZ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 113.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.90 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|